C16H16F3N3O5S — CID 21026141
methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)-3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid (PubChem CID 21026141) has the molecular formula C16H16F3N3O5S and a molecular weight of 419.38 g/mol. Its IUPAC name is methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)-3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid.
| Compound Name | methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)-3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 21026141 |
| Molecular Formula | C16H16F3N3O5S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)-3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid |
| SMILES | CN(C[C@@H]1CN(c2ccc(N3CCOC3=O)c(C(F)(F)F)c2)C(=O)O1)C(=O)S |
| InChI | InChI=1S/C16H16F3N3O5S/c1-20(15(25)28)7-10-8-22(14(24)27-10)9-2-3-12(11(6-9)16(17,18)19)21-4-5-26-13(21)23/h2-3,6,10H,4-5,7-8H2,1H3,(H,25,28)/t10-/m1/s1 |
| InChIKey | BFIHUCKLNKHTRM-SNVBAGLBSA-N |
| XLogP | 2.97 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|