C16H19FN4O3S2 — CID 91535704
[(5S)-3-[3-fluoro-4-(3-methyl-2-sulfanylideneimidazolidin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-methylcarbamothioic S-acid (PubChem CID 91535704) has the molecular formula C16H19FN4O3S2 and a molecular weight of 398.49 g/mol. Its IUPAC name is [(5S)-3-[3-fluoro-4-(3-methyl-2-sulfanylideneimidazolidin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-methylcarbamothioic S-acid.
| Compound Name | [(5S)-3-[3-fluoro-4-(3-methyl-2-sulfanylideneimidazolidin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 91535704 |
| Molecular Formula | C16H19FN4O3S2 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [(5S)-3-[3-fluoro-4-(3-methyl-2-sulfanylideneimidazolidin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl-methylcarbamothioic S-acid |
| SMILES | CN(C[C@@H]1CN(c2ccc(C3CNC(=S)N3C)c(F)c2)C(=O)O1)C(=O)S |
| InChI | InChI=1S/C16H19FN4O3S2/c1-19(16(23)26)7-10-8-21(15(22)24-10)9-3-4-11(12(17)5-9)13-6-18-14(25)20(13)2/h3-5,10,13H,6-8H2,1-2H3,(H,18,25)(H,23,26)/t10-,13?/m1/s1 |
| InChIKey | BPJWOBIPXDVHAQ-VUUHIHSGSA-N |
| XLogP | 1.99 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|