C19H17N3O5S — CID 21026145
methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-benzoxazol-3-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid (PubChem CID 21026145) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-benzoxazol-3-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid.
| Compound Name | methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-benzoxazol-3-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 21026145 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | methyl-[[(5S)-2-oxo-3-[4-(2-oxo-1,3-benzoxazol-3-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamothioic S-acid |
| SMILES | CN(C[C@@H]1CN(c2ccc(-n3c(=O)oc4ccccc43)cc2)C(=O)O1)C(=O)S |
| InChI | InChI=1S/C19H17N3O5S/c1-20(19(25)28)10-14-11-21(17(23)26-14)12-6-8-13(9-7-12)22-15-4-2-3-5-16(15)27-18(22)24/h2-9,14H,10-11H2,1H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | RQBPWWMDKHKINC-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|