C18H21N5O3 — CID 166269260
N-methyl-N-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxamide (PubChem CID 166269260) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-methyl-N-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-methyl-N-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 166269260 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-methyl-N-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-7-carboxamide |
| SMILES | CN(CC1CN(c2ccccc2)C(=O)O1)C(=O)C1CCn2ncnc2C1 |
| InChI | InChI=1S/C18H21N5O3/c1-21(17(24)13-7-8-23-16(9-13)19-12-20-23)10-15-11-22(18(25)26-15)14-5-3-2-4-6-14/h2-6,12-13,15H,7-11H2,1H3 |
| InChIKey | FNQCJMMEESZNEG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |