C26H19F2N9O12S4 — CID 21028627
2-[[2,6-diamino-3-[[5-[(2,6-difluoropyrimidin-4-yl)amino]-2-sulfophenyl]diazenyl]-5-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 21028627) has the molecular formula C26H19F2N9O12S4 and a molecular weight of 815.75 g/mol. Its IUPAC name is 2-[[2,6-diamino-3-[[5-[(2,6-difluoropyrimidin-4-yl)amino]-2-sulfophenyl]diazenyl]-5-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[[2,6-diamino-3-[[5-[(2,6-difluoropyrimidin-4-yl)amino]-2-sulfophenyl]diazenyl]-5-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 21028627 |
| Molecular Formula | C26H19F2N9O12S4 |
| Molecular Weight | 815.75 g/mol |
| Exact Mass | 815.00 |
| IUPAC Name | 2-[[2,6-diamino-3-[[5-[(2,6-difluoropyrimidin-4-yl)amino]-2-sulfophenyl]diazenyl]-5-sulfophenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | Nc1c(/N=N/c2cc(Nc3cc(F)nc(F)n3)ccc2S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c1/N=N/c1ccc2c(S(=O)(=O)O)cccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C26H19F2N9O12S4/c27-20-10-21(33-26(28)32-20)31-11-4-7-18(51(41,42)43)15(8-11)35-36-16-9-19(52(44,45)46)23(30)24(22(16)29)37-34-14-6-5-12-13(25(14)53(47,48)49)2-1-3-17(12)50(38,39)40/h1-10H,29-30H2,(H,31,32,33)(H,38,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)/b36-35+,37-34+ |
| InChIKey | CLFZKFWWHZZSSS-IALZAULJSA-N |
| XLogP | 4.63 |
| TPSA | 356.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.75 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|