C16H26N4O3 — CID 21032407
5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline (PubChem CID 21032407) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline.
| Compound Name | 5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 21032407 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline |
| SMILES | CCN(CC)C[C@@H]1CN(c2ccc([N+](=O)[O-])c(N)c2)[C@@H](C)CO1 |
| InChI | InChI=1S/C16H26N4O3/c1-4-18(5-2)9-14-10-19(12(3)11-23-14)13-6-7-16(20(21)22)15(17)8-13/h6-8,12,14H,4-5,9-11,17H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | UBHMULAUVWJIBD-GXTWGEPZSA-N |
| XLogP | 2.11 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|