C32H54N8O4 — CID 158435072
4-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]benzene-1,2-diamine;5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline (PubChem CID 158435072) has the molecular formula C32H54N8O4 and a molecular weight of 614.84 g/mol. Its IUPAC name is 4-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]benzene-1,2-diamine;5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline.
| Compound Name | 4-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]benzene-1,2-diamine;5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 158435072 |
| Molecular Formula | C32H54N8O4 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.43 |
| IUPAC Name | 4-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]benzene-1,2-diamine;5-[(2R,5S)-2-(diethylaminomethyl)-5-methylmorpholin-4-yl]-2-nitroaniline |
| SMILES | CCN(CC)C[C@@H]1CN(c2ccc(N)c(N)c2)[C@@H](C)CO1.CCN(CC)C[C@@H]1CN(c2ccc([N+](=O)[O-])c(N)c2)[C@@H](C)CO1 |
| InChI | InChI=1S/C16H26N4O3.C16H28N4O/c1-4-18(5-2)9-14-10-19(12(3)11-23-14)13-6-7-16(20(21)22)15(17)8-13;1-4-19(5-2)9-14-10-20(12(3)11-21-14)13-6-7-15(17)16(18)8-13/h6-8,12,14H,4-5,9-11,17H2,1-3H3;6-8,12,14H,4-5,9-11,17-18H2,1-3H3/t2*12-,14+/m00/s1 |
| InChIKey | HCCWZKAPBMVEIY-QUYRBMQUSA-N |
| XLogP | 3.90 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|