C17H17N5O3S2 — CID 21036636
1-[[6-(1,3-benzodioxol-5-yl)thieno[3,2-d]pyrimidin-4-yl]amino]-3-(2-methoxyethyl)thiourea (PubChem CID 21036636) has the molecular formula C17H17N5O3S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[[6-(1,3-benzodioxol-5-yl)thieno[3,2-d]pyrimidin-4-yl]amino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[[6-(1,3-benzodioxol-5-yl)thieno[3,2-d]pyrimidin-4-yl]amino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 21036636 |
| Molecular Formula | C17H17N5O3S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-[[6-(1,3-benzodioxol-5-yl)thieno[3,2-d]pyrimidin-4-yl]amino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NNc1ncnc2cc(-c3ccc4c(c3)OCO4)sc12 |
| InChI | InChI=1S/C17H17N5O3S2/c1-23-5-4-18-17(26)22-21-16-15-11(19-8-20-16)7-14(27-15)10-2-3-12-13(6-10)25-9-24-12/h2-3,6-8H,4-5,9H2,1H3,(H2,18,22,26)(H,19,20,21) |
| InChIKey | PZPJKHCKORIGBA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|