C17H15ClN2 — CID 21036742
4-[4-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]pyridine (PubChem CID 21036742) has the molecular formula C17H15ClN2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]pyridine.
| Compound Name | 4-[4-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]pyridine |
|---|---|
| PubChem CID | 21036742 |
| Molecular Formula | C17H15ClN2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]pyridine |
| SMILES | Cc1c(-c2ccncc2)c(-c2ccc(Cl)cc2)cn1C |
| InChI | InChI=1S/C17H15ClN2/c1-12-17(14-7-9-19-10-8-14)16(11-20(12)2)13-3-5-15(18)6-4-13/h3-11H,1-2H3 |
| InChIKey | LRMWLYUTBJMWBI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |