C12H11NO2S2 — CID 21037073
(2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl)-(furan-2-yl)methanone (PubChem CID 21037073) has the molecular formula C12H11NO2S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl)-(furan-2-yl)methanone.
| Compound Name | (2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 21037073 |
| Molecular Formula | C12H11NO2S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | (2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-yl)-(furan-2-yl)methanone |
| SMILES | Nc1sc2c(c1C(=O)c1ccco1)CCSC2 |
| InChI | InChI=1S/C12H11NO2S2/c13-12-10(11(14)8-2-1-4-15-8)7-3-5-16-6-9(7)17-12/h1-2,4H,3,5-6,13H2 |
| InChIKey | HNBXPQYSPXRZJG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|