C12H11NO3S — CID 67300732
(2-amino-4-methyl-4,6-dihydrothieno[2,3-c]furan-3-yl)-(furan-2-yl)methanone (PubChem CID 67300732) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is (2-amino-4-methyl-4,6-dihydrothieno[2,3-c]furan-3-yl)-(furan-2-yl)methanone.
| Compound Name | (2-amino-4-methyl-4,6-dihydrothieno[2,3-c]furan-3-yl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 67300732 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (2-amino-4-methyl-4,6-dihydrothieno[2,3-c]furan-3-yl)-(furan-2-yl)methanone |
| SMILES | CC1OCc2sc(N)c(C(=O)c3ccco3)c21 |
| InChI | InChI=1S/C12H11NO3S/c1-6-9-8(5-16-6)17-12(13)10(9)11(14)7-3-2-4-15-7/h2-4,6H,5,13H2,1H3 |
| InChIKey | RMKJVZWPIQEESK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|