C23H16F6N2S4 — CID 21044737
5-[3,3,4,4,5,5-hexafluoro-2-[4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole (PubChem CID 21044737) has the molecular formula C23H16F6N2S4 and a molecular weight of 562.65 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-[4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-[4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 21044737 |
| Molecular Formula | C23H16F6N2S4 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-[4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole |
| SMILES | Cc1ccc(-c2nc(C)c(C3=C(c4sc(-c5ccc(C)s5)nc4C)C(F)(F)C(F)(F)C3(F)F)s2)s1 |
| InChI | InChI=1S/C23H16F6N2S4/c1-9-5-7-13(32-9)19-30-11(3)17(34-19)15-16(22(26,27)23(28,29)21(15,24)25)18-12(4)31-20(35-18)14-8-6-10(2)33-14/h5-8H,1-4H3 |
| InChIKey | HXPWUCOHLGNADV-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|