C7H5IN2S2 — CID 63383792
2-iodo-5-(5-methylthiophen-2-yl)-1,3,4-thiadiazole (PubChem CID 63383792) has the molecular formula C7H5IN2S2 and a molecular weight of 308.17 g/mol. Its IUPAC name is 2-iodo-5-(5-methylthiophen-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-iodo-5-(5-methylthiophen-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383792 |
| Molecular Formula | C7H5IN2S2 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.89 |
| IUPAC Name | 2-iodo-5-(5-methylthiophen-2-yl)-1,3,4-thiadiazole |
| SMILES | Cc1ccc(-c2nnc(I)s2)s1 |
| InChI | InChI=1S/C7H5IN2S2/c1-4-2-3-5(11-4)6-9-10-7(8)12-6/h2-3H,1H3 |
| InChIKey | SXTZMIJFLLRLMS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|