C32H39NO4S — CID 21046941
N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide (PubChem CID 21046941) has the molecular formula C32H39NO4S and a molecular weight of 533.73 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 21046941 |
| Molecular Formula | C32H39NO4S |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide |
| SMILES | COc1cc2c(cc1-c1ccc(C(=O)NC3COC(C)(C)OC3c3ccccc3)s1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H39NO4S/c1-30(2)15-16-31(3,4)23-18-25(35-7)21(17-22(23)30)26-13-14-27(38-26)29(34)33-24-19-36-32(5,6)37-28(24)20-11-9-8-10-12-20/h8-14,17-18,24,28H,15-16,19H2,1-7H3,(H,33,34) |
| InChIKey | GLCTYVUMKWTIOQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |