C29H35NO4S — CID 21047239
N-[(2,6-dimethoxyphenyl)methyl]-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide (PubChem CID 21047239) has the molecular formula C29H35NO4S and a molecular weight of 493.67 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide.
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 21047239 |
| Molecular Formula | C29H35NO4S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]-5-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)thiophene-2-carboxamide |
| SMILES | COc1cc2c(cc1-c1ccc(C(=O)NCc3c(OC)cccc3OC)s1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H35NO4S/c1-28(2)13-14-29(3,4)21-16-24(34-7)18(15-20(21)28)25-11-12-26(35-25)27(31)30-17-19-22(32-5)9-8-10-23(19)33-6/h8-12,15-16H,13-14,17H2,1-7H3,(H,30,31) |
| InChIKey | NQVAKJIOXXMOFE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |