C53H47AlCl2N4O3 — CID 21051673
6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-chloro-4-phenylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine (PubChem CID 21051673) has the molecular formula C53H47AlCl2N4O3 and a molecular weight of 885.87 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-chloro-4-phenylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine.
| Compound Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-chloro-4-phenylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 21051673 |
| Molecular Formula | C53H47AlCl2N4O3 |
| Molecular Weight | 885.87 g/mol |
| Exact Mass | 884.28 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-chloro-4-phenylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine |
| SMILES | Clc1ccc(O[Al](Oc2ccc(CNCCCCCCC3CC4C=CC3C4)c3cccnc23)Oc2ccc(Cl)c3c(-c4ccccc4)ccnc23)c2nccc(-c3ccccc3)c12 |
| InChI | InChI=1S/C23H30N2O.2C15H10ClNO.Al/c26-22-11-10-20(21-7-5-13-25-23(21)22)16-24-12-4-2-1-3-6-18-14-17-8-9-19(18)15-17;2*16-12-6-7-13(18)15-14(12)11(8-9-17-15)10-4-2-1-3-5-10;/h5,7-11,13,17-19,24,26H,1-4,6,12,14-16H2;2*1-9,18H;/q;;;+3/p-3 |
| InChIKey | VQJANIGDWXOKLZ-UHFFFAOYSA-K |
| XLogP | 13.75 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.87 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|