C41H39AlN6O7 — CID 21051656
6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-nitroquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine (PubChem CID 21051656) has the molecular formula C41H39AlN6O7 and a molecular weight of 754.78 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-nitroquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine.
| Compound Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-nitroquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 21051656 |
| Molecular Formula | C41H39AlN6O7 |
| Molecular Weight | 754.78 g/mol |
| Exact Mass | 754.27 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5-nitroquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine |
| SMILES | O=[N+]([O-])c1ccc(O[Al](Oc2ccc(CNCCCCCCC3CC4C=CC3C4)c3cccnc23)Oc2ccc([N+](=O)[O-])c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C23H30N2O.2C9H6N2O3.Al/c26-22-11-10-20(21-7-5-13-25-23(21)22)16-24-12-4-2-1-3-6-18-14-17-8-9-19(18)15-17;2*12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8;/h5,7-11,13,17-19,24,26H,1-4,6,12,14-16H2;2*1-5,12H;/q;;;+3/p-3 |
| InChIKey | PWRUQJBCQRPOIZ-UHFFFAOYSA-K |
| XLogP | 8.92 |
| TPSA | 164.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.78 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|