C43H41AlN4O5 — CID 21051655
8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-formylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-carbaldehyde (PubChem CID 21051655) has the molecular formula C43H41AlN4O5 and a molecular weight of 720.81 g/mol. Its IUPAC name is 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-formylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-carbaldehyde.
| Compound Name | 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-formylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-carbaldehyde |
|---|---|
| PubChem CID | 21051655 |
| Molecular Formula | C43H41AlN4O5 |
| Molecular Weight | 720.81 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-formylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-carbaldehyde |
| SMILES | O=Cc1ccc(O[Al](Oc2ccc(C=O)c3cccnc23)Oc2ccc(CNCCCCCCC3CC4C=CC3C4)c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C23H30N2O.2C10H7NO2.Al/c26-22-11-10-20(21-7-5-13-25-23(21)22)16-24-12-4-2-1-3-6-18-14-17-8-9-19(18)15-17;2*12-6-7-3-4-9(13)10-8(7)2-1-5-11-10;/h5,7-11,13,17-19,24,26H,1-4,6,12,14-16H2;2*1-6,13H;/q;;;+3/p-3 |
| InChIKey | BNAGZOPMAUIJNK-UHFFFAOYSA-K |
| XLogP | 8.73 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.81 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|