C43H41AlCl4N4O3 — CID 21051678
6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5,7-dichloro-2-methylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine (PubChem CID 21051678) has the molecular formula C43H41AlCl4N4O3 and a molecular weight of 830.62 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5,7-dichloro-2-methylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine.
| Compound Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5,7-dichloro-2-methylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 21051678 |
| Molecular Formula | C43H41AlCl4N4O3 |
| Molecular Weight | 830.62 g/mol |
| Exact Mass | 828.17 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]hept-5-enyl)-N-[[8-bis[(5,7-dichloro-2-methylquinolin-8-yl)oxy]alumanyloxyquinolin-5-yl]methyl]hexan-1-amine |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(O[Al](Oc3ccc(CNCCCCCCC4CC5C=CC4C5)c4cccnc34)Oc3c(Cl)cc(Cl)c4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C23H30N2O.2C10H7Cl2NO.Al/c26-22-11-10-20(21-7-5-13-25-23(21)22)16-24-12-4-2-1-3-6-18-14-17-8-9-19(18)15-17;2*1-5-2-3-6-7(11)4-8(12)10(14)9(6)13-5;/h5,7-11,13,17-19,24,26H,1-4,6,12,14-16H2;2*2-4,14H,1H3;/q;;;+3/p-3 |
| InChIKey | JHGQIQSOMPNQJR-UHFFFAOYSA-K |
| XLogP | 12.34 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.62 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|