C43H45AlN4O6S — CID 21051677
8-[[5-[[6-(2-bicyclo[2.2.2]oct-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid (PubChem CID 21051677) has the molecular formula C43H45AlN4O6S and a molecular weight of 772.90 g/mol. Its IUPAC name is 8-[[5-[[6-(2-bicyclo[2.2.2]oct-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid.
| Compound Name | 8-[[5-[[6-(2-bicyclo[2.2.2]oct-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 21051677 |
| Molecular Formula | C43H45AlN4O6S |
| Molecular Weight | 772.90 g/mol |
| Exact Mass | 772.29 |
| IUPAC Name | 8-[[5-[[6-(2-bicyclo[2.2.2]oct-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid |
| SMILES | Cc1ccc(O[Al](Oc2ccc(CNCCCCCCC3CC4C=CC3CC4)c3cccnc23)Oc2ccc(S(=O)(=O)O)c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C24H32N2O.C10H9NO.C9H7NO4S.Al/c27-23-13-12-21(22-7-5-15-26-24(22)23)17-25-14-4-2-1-3-6-20-16-18-8-10-19(20)11-9-18;1-7-4-5-9(12)10-8(7)3-2-6-11-10;11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h5,7-8,10,12-13,15,18-20,25,27H,1-4,6,9,11,14,16-17H2;2-6,12H,1H3;1-5,11H,(H,12,13,14);/q;;;+3/p-3 |
| InChIKey | YXYNYSNGFSNKLV-UHFFFAOYSA-K |
| XLogP | 9.05 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.90 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|