C42H43AlN4O6S — CID 21051676
8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid (PubChem CID 21051676) has the molecular formula C42H43AlN4O6S and a molecular weight of 758.88 g/mol. Its IUPAC name is 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid.
| Compound Name | 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 21051676 |
| Molecular Formula | C42H43AlN4O6S |
| Molecular Weight | 758.88 g/mol |
| Exact Mass | 758.27 |
| IUPAC Name | 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-methylquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid |
| SMILES | Cc1ccc(O[Al](Oc2ccc(CNCCCCCCC3CC4C=CC3C4)c3cccnc23)Oc2ccc(S(=O)(=O)O)c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C23H30N2O.C10H9NO.C9H7NO4S.Al/c26-22-11-10-20(21-7-5-13-25-23(21)22)16-24-12-4-2-1-3-6-18-14-17-8-9-19(18)15-17;1-7-4-5-9(12)10-8(7)3-2-6-11-10;11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h5,7-11,13,17-19,24,26H,1-4,6,12,14-16H2;2-6,12H,1H3;1-5,11H,(H,12,13,14);/q;;;+3/p-3 |
| InChIKey | FELCPWHKFXKTEJ-UHFFFAOYSA-K |
| XLogP | 8.66 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.88 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|