C41H41AlN4O9S2 — CID 21051657
8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-sulfoquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid (PubChem CID 21051657) has the molecular formula C41H41AlN4O9S2 and a molecular weight of 824.91 g/mol. Its IUPAC name is 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-sulfoquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid.
| Compound Name | 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-sulfoquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 21051657 |
| Molecular Formula | C41H41AlN4O9S2 |
| Molecular Weight | 824.91 g/mol |
| Exact Mass | 824.21 |
| IUPAC Name | 8-[[5-[[6-(2-bicyclo[2.2.1]hept-5-enyl)hexylamino]methyl]quinolin-8-yl]oxy-(5-sulfoquinolin-8-yl)oxyalumanyl]oxyquinoline-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O[Al](Oc2ccc(CNCCCCCCC3CC4C=CC3C4)c3cccnc23)Oc2ccc(S(=O)(=O)O)c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C23H30N2O.2C9H7NO4S.Al/c26-22-11-10-20(21-7-5-13-25-23(21)22)16-24-12-4-2-1-3-6-18-14-17-8-9-19(18)15-17;2*11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h5,7-11,13,17-19,24,26H,1-4,6,12,14-16H2;2*1-5,11H,(H,12,13,14);/q;;;+3/p-3 |
| InChIKey | JJEMVDLTKPBRIV-UHFFFAOYSA-K |
| XLogP | 7.60 |
| TPSA | 187.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.91 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|