C41H49NO7 — CID 21051968
[5-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(2,2-dimethylpropanoyloxy)-5-methyl-11H-chromeno[4,3-c]chromen-8-yl] 2,2-dimethylpropanoate (PubChem CID 21051968) has the molecular formula C41H49NO7 and a molecular weight of 667.84 g/mol. Its IUPAC name is [5-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(2,2-dimethylpropanoyloxy)-5-methyl-11H-chromeno[4,3-c]chromen-8-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(2,2-dimethylpropanoyloxy)-5-methyl-11H-chromeno[4,3-c]chromen-8-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 21051968 |
| Molecular Formula | C41H49NO7 |
| Molecular Weight | 667.84 g/mol |
| Exact Mass | 667.35 |
| IUPAC Name | [5-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(2,2-dimethylpropanoyloxy)-5-methyl-11H-chromeno[4,3-c]chromen-8-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)OC(C)(c1ccc(OCCN3CCCCCC3)cc1)C1=C2COc2cc(OC(=O)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C41H49NO7/c1-39(2,3)37(43)47-29-17-19-32-34(24-29)46-26-33-31-18-16-30(48-38(44)40(4,5)6)25-35(31)49-41(7,36(32)33)27-12-14-28(15-13-27)45-23-22-42-20-10-8-9-11-21-42/h12-19,24-25H,8-11,20-23,26H2,1-7H3 |
| InChIKey | JHQLTIXDZKXLTE-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.84 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|