C35H39NO5 — CID 91453957
[5-methyl-5-[3-(2-piperidin-1-ylethoxy)phenyl]-11H-chromeno[4,3-c]chromen-2-yl] 2,2-dimethylpropanoate (PubChem CID 91453957) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is [5-methyl-5-[3-(2-piperidin-1-ylethoxy)phenyl]-11H-chromeno[4,3-c]chromen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-methyl-5-[3-(2-piperidin-1-ylethoxy)phenyl]-11H-chromeno[4,3-c]chromen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91453957 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | [5-methyl-5-[3-(2-piperidin-1-ylethoxy)phenyl]-11H-chromeno[4,3-c]chromen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)OCC1=C2C(C)(c2cccc(OCCN3CCCCC3)c2)Oc2ccccc21 |
| InChI | InChI=1S/C35H39NO5/c1-34(2,3)33(37)40-26-15-16-28-31(22-26)39-23-29-27-13-6-7-14-30(27)41-35(4,32(28)29)24-11-10-12-25(21-24)38-20-19-36-17-8-5-9-18-36/h6-7,10-16,21-22H,5,8-9,17-20,23H2,1-4H3 |
| InChIKey | RJWVIIXRCBDTHT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|