C14H13N5O2 — CID 21054791
4-(6-aminopyrimidin-4-yl)oxy-N-methylindole-1-carboxamide (PubChem CID 21054791) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 4-(6-aminopyrimidin-4-yl)oxy-N-methylindole-1-carboxamide.
| Compound Name | 4-(6-aminopyrimidin-4-yl)oxy-N-methylindole-1-carboxamide |
|---|---|
| PubChem CID | 21054791 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-(6-aminopyrimidin-4-yl)oxy-N-methylindole-1-carboxamide |
| SMILES | CNC(=O)n1ccc2c(Oc3cc(N)ncn3)cccc21 |
| InChI | InChI=1S/C14H13N5O2/c1-16-14(20)19-6-5-9-10(19)3-2-4-11(9)21-13-7-12(15)17-8-18-13/h2-8H,1H3,(H,16,20)(H2,15,17,18) |
| InChIKey | UUTSUXBISWBVGZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |