C17H16N6O5 — CID 90795443
carbamoyl 4-[6-(ethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate (PubChem CID 90795443) has the molecular formula C17H16N6O5 and a molecular weight of 384.35 g/mol. Its IUPAC name is carbamoyl 4-[6-(ethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate.
| Compound Name | carbamoyl 4-[6-(ethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate |
|---|---|
| PubChem CID | 90795443 |
| Molecular Formula | C17H16N6O5 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | carbamoyl 4-[6-(ethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate |
| SMILES | CCNC(=O)Nc1cc(Oc2cccc3c2ccn3C(=O)OC(N)=O)ncn1 |
| InChI | InChI=1S/C17H16N6O5/c1-2-19-16(25)22-13-8-14(21-9-20-13)27-12-5-3-4-11-10(12)6-7-23(11)17(26)28-15(18)24/h3-9H,2H2,1H3,(H2,18,24)(H2,19,20,21,22,25) |
| InChIKey | QVEJDEFRRDIUSM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|