C19H20N6O5 — CID 90741762
carbamoyl 4-[6-(diethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate (PubChem CID 90741762) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is carbamoyl 4-[6-(diethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate.
| Compound Name | carbamoyl 4-[6-(diethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate |
|---|---|
| PubChem CID | 90741762 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | carbamoyl 4-[6-(diethylcarbamoylamino)pyrimidin-4-yl]oxyindole-1-carboxylate |
| SMILES | CCN(CC)C(=O)Nc1cc(Oc2cccc3c2ccn3C(=O)OC(N)=O)ncn1 |
| InChI | InChI=1S/C19H20N6O5/c1-3-24(4-2)18(27)23-15-10-16(22-11-21-15)29-14-7-5-6-13-12(14)8-9-25(13)19(28)30-17(20)26/h5-11H,3-4H2,1-2H3,(H2,20,26)(H,21,22,23,27) |
| InChIKey | ZGLUYZPYOMBZMK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|