C10H11N — CID 21059285
4-methyl-2,6-dihydroisoquinoline (PubChem CID 21059285) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-methyl-2,6-dihydroisoquinoline.
| Compound Name | 4-methyl-2,6-dihydroisoquinoline |
|---|---|
| PubChem CID | 21059285 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4-methyl-2,6-dihydroisoquinoline |
| SMILES | CC1=CNC=C2C=CCC=C12 |
| InChI | InChI=1S/C10H11N/c1-8-6-11-7-9-4-2-3-5-10(8)9/h2,4-7,11H,3H2,1H3 |
| InChIKey | OVSFVBGHHIGNDJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |