C9H17F3N2O2S — CID 21061568
1-tert-butyl-4-(trifluoromethylsulfonyl)piperazine (PubChem CID 21061568) has the molecular formula C9H17F3N2O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-tert-butyl-4-(trifluoromethylsulfonyl)piperazine.
| Compound Name | 1-tert-butyl-4-(trifluoromethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 21061568 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-tert-butyl-4-(trifluoromethylsulfonyl)piperazine |
| SMILES | CC(C)(C)N1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N2O2S/c1-8(2,3)13-4-6-14(7-5-13)17(15,16)9(10,11)12/h4-7H2,1-3H3 |
| InChIKey | ZECTZSOYGNDMAY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |