C21H21N5OS — CID 21064921
6-piperidin-1-yl-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 21064921) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 6-piperidin-1-yl-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one.
| Compound Name | 6-piperidin-1-yl-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 21064921 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6-piperidin-1-yl-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | O=C1Nc2ccc(N3CCCCC3)cc2CN1c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C21H21N5OS/c27-20-23-18-5-4-17(25-10-2-1-3-11-25)12-16(18)13-26(20)21-24-19(14-28-21)15-6-8-22-9-7-15/h4-9,12,14H,1-3,10-11,13H2,(H,23,27) |
| InChIKey | BDCHWOHWASTUDA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|