C15H13FO3 — CID 21071411
2-[3-(3-fluorophenoxy)phenyl]-1,3-dioxolane (PubChem CID 21071411) has the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-[3-(3-fluorophenoxy)phenyl]-1,3-dioxolane.
| Compound Name | 2-[3-(3-fluorophenoxy)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 21071411 |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[3-(3-fluorophenoxy)phenyl]-1,3-dioxolane |
| SMILES | Fc1cccc(Oc2cccc(C3OCCO3)c2)c1 |
| InChI | InChI=1S/C15H13FO3/c16-12-4-2-6-14(10-12)19-13-5-1-3-11(9-13)15-17-7-8-18-15/h1-6,9-10,15H,7-8H2 |
| InChIKey | JZCBORZPOSQFMB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |