C16H13ClN2O3S — CID 21071905
5-[(4-chloro-2,3-dihydroindol-1-yl)sulfonyl]-1,3-dihydroindol-2-one (PubChem CID 21071905) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is 5-[(4-chloro-2,3-dihydroindol-1-yl)sulfonyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(4-chloro-2,3-dihydroindol-1-yl)sulfonyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 21071905 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5-[(4-chloro-2,3-dihydroindol-1-yl)sulfonyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)N3CCc4c(Cl)cccc43)ccc2N1 |
| InChI | InChI=1S/C16H13ClN2O3S/c17-13-2-1-3-15-12(13)6-7-19(15)23(21,22)11-4-5-14-10(8-11)9-16(20)18-14/h1-5,8H,6-7,9H2,(H,18,20) |
| InChIKey | REQASQKTMBSXGR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |