C14H11ClN2O6S — CID 21072446
3-(5-chloro-2-hydroxy-3-nitrophenyl)-N-methylsulfonylbenzamide (PubChem CID 21072446) has the molecular formula C14H11ClN2O6S and a molecular weight of 370.77 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxy-3-nitrophenyl)-N-methylsulfonylbenzamide.
| Compound Name | 3-(5-chloro-2-hydroxy-3-nitrophenyl)-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 21072446 |
| Molecular Formula | C14H11ClN2O6S |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 3-(5-chloro-2-hydroxy-3-nitrophenyl)-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cccc(-c2cc(Cl)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C14H11ClN2O6S/c1-24(22,23)16-14(19)9-4-2-3-8(5-9)11-6-10(15)7-12(13(11)18)17(20)21/h2-7,18H,1H3,(H,16,19) |
| InChIKey | FORFSDTUTGGNNI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|