C22H19N5O5S — CID 21074013
3-benzyl-1,5-dimethyl-6-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]pyrimidine-2,4-dione (PubChem CID 21074013) has the molecular formula C22H19N5O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is 3-benzyl-1,5-dimethyl-6-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1,5-dimethyl-6-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21074013 |
| Molecular Formula | C22H19N5O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-benzyl-1,5-dimethyl-6-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]pyrimidine-2,4-dione |
| SMILES | Cc1c(SCc2nnc(-c3cccc([N+](=O)[O-])c3)o2)n(C)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H19N5O5S/c1-14-20(28)26(12-15-7-4-3-5-8-15)22(29)25(2)21(14)33-13-18-23-24-19(32-18)16-9-6-10-17(11-16)27(30)31/h3-11H,12-13H2,1-2H3 |
| InChIKey | POWVNOVWEGSYBI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 126.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|