C18H13N5O4 — CID 24851274
3-methyl-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]quinoxalin-2-one (PubChem CID 24851274) has the molecular formula C18H13N5O4 and a molecular weight of 363.33 g/mol. Its IUPAC name is 3-methyl-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]quinoxalin-2-one.
| Compound Name | 3-methyl-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 24851274 |
| Molecular Formula | C18H13N5O4 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-methyl-1-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]quinoxalin-2-one |
| SMILES | Cc1nc2ccccc2n(Cc2nnc(-c3cccc([N+](=O)[O-])c3)o2)c1=O |
| InChI | InChI=1S/C18H13N5O4/c1-11-18(24)22(15-8-3-2-7-14(15)19-11)10-16-20-21-17(27-16)12-5-4-6-13(9-12)23(25)26/h2-9H,10H2,1H3 |
| InChIKey | YNBZXSBNWIVWJO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|