C20H18N5O5+ — CID 9243501
cyclopropyl-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-[(2-oxo-1,3-benzoxazol-3-yl)methyl]azanium (PubChem CID 9243501) has the molecular formula C20H18N5O5+ and a molecular weight of 408.39 g/mol. Its IUPAC name is cyclopropyl-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-[(2-oxo-1,3-benzoxazol-3-yl)methyl]azanium.
| Compound Name | cyclopropyl-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-[(2-oxo-1,3-benzoxazol-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 9243501 |
| Molecular Formula | C20H18N5O5+ |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | cyclopropyl-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-[(2-oxo-1,3-benzoxazol-3-yl)methyl]azanium |
| SMILES | O=c1oc2ccccc2n1C[NH+](Cc1nnc(-c2cccc([N+](=O)[O-])c2)o1)C1CC1 |
| InChI | InChI=1S/C20H17N5O5/c26-20-24(16-6-1-2-7-17(16)29-20)12-23(14-8-9-14)11-18-21-22-19(30-18)13-4-3-5-15(10-13)25(27)28/h1-7,10,14H,8-9,11-12H2/p+1 |
| InChIKey | RTSFQKSXIPWHBL-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|