C18H17N5O3S — CID 21092638
1-(4-aminosulfanylperoxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carbohydrazide (PubChem CID 21092638) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-(4-aminosulfanylperoxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carbohydrazide.
| Compound Name | 1-(4-aminosulfanylperoxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 21092638 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-(4-aminosulfanylperoxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carbohydrazide |
| SMILES | NNC(=O)c1nn(-c2ccc(OOSN)cc2)c2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C18H17N5O3S/c19-21-18(24)16-15-10-5-11-3-1-2-4-14(11)17(15)23(22-16)12-6-8-13(9-7-12)25-26-27-20/h1-4,6-9H,5,10,19-20H2,(H,21,24) |
| InChIKey | XAFUAYLMNMMNNC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|