C13H12N4O2S — CID 21093483
5-(2-nitroanilino)-2-propan-2-yl-1,3-thiazole-4-carbonitrile (PubChem CID 21093483) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-(2-nitroanilino)-2-propan-2-yl-1,3-thiazole-4-carbonitrile.
| Compound Name | 5-(2-nitroanilino)-2-propan-2-yl-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 21093483 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-(2-nitroanilino)-2-propan-2-yl-1,3-thiazole-4-carbonitrile |
| SMILES | CC(C)c1nc(C#N)c(Nc2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H12N4O2S/c1-8(2)12-16-10(7-14)13(20-12)15-9-5-3-4-6-11(9)17(18)19/h3-6,8,15H,1-2H3 |
| InChIKey | FNYVDQGVLAVEMS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|