C13H17N5O2S — CID 71850448
N-(2-nitrophenyl)-N'-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine (PubChem CID 71850448) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(2-nitrophenyl)-N'-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2-nitrophenyl)-N'-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71850448 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(2-nitrophenyl)-N'-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)c1nnc(NCCNc2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H17N5O2S/c1-9(2)12-16-17-13(21-12)15-8-7-14-10-5-3-4-6-11(10)18(19)20/h3-6,9,14H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | QTPGIJJOJLOVDE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|