C21H26N4O2 — CID 21098476
N-[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-1H-indazol-5-amine (PubChem CID 21098476) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-1H-indazol-5-amine.
| Compound Name | N-[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 21098476 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[1-[(3,5-dimethoxyphenyl)methyl]piperidin-4-yl]-1H-indazol-5-amine |
| SMILES | COc1cc(CN2CCC(Nc3ccc4[nH]ncc4c3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H26N4O2/c1-26-19-9-15(10-20(12-19)27-2)14-25-7-5-17(6-8-25)23-18-3-4-21-16(11-18)13-22-24-21/h3-4,9-13,17,23H,5-8,14H2,1-2H3,(H,22,24) |
| InChIKey | SIQSCNBPKIFTKR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |