C22H27Cl2FN2O — CID 21110207
N-[2-[(2-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]-2-fluorobenzamide;hydrochloride (PubChem CID 21110207) has the molecular formula C22H27Cl2FN2O and a molecular weight of 425.38 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]-2-fluorobenzamide;hydrochloride.
| Compound Name | N-[2-[(2-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]-2-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 21110207 |
| Molecular Formula | C22H27Cl2FN2O |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[2-[(2-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]-2-fluorobenzamide;hydrochloride |
| SMILES | CN(C)C(c1ccccc1Cl)C1CCCCC1NC(=O)c1ccccc1F.Cl |
| InChI | InChI=1S/C22H26ClFN2O.ClH/c1-26(2)21(15-9-3-6-12-18(15)23)17-11-5-8-14-20(17)25-22(27)16-10-4-7-13-19(16)24;/h3-4,6-7,9-10,12-13,17,20-21H,5,8,11,14H2,1-2H3,(H,25,27);1H |
| InChIKey | ITHAGXXJOOIQGU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |