C30H33NO5 — CID 21110643
ethyl 3-[[7-[4-hydroxy-3-(1-phenylpropan-2-yl)phenoxy]-6-methyl-2,3-dihydro-1H-inden-4-yl]amino]-3-oxopropanoate (PubChem CID 21110643) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is ethyl 3-[[7-[4-hydroxy-3-(1-phenylpropan-2-yl)phenoxy]-6-methyl-2,3-dihydro-1H-inden-4-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[7-[4-hydroxy-3-(1-phenylpropan-2-yl)phenoxy]-6-methyl-2,3-dihydro-1H-inden-4-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 21110643 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | ethyl 3-[[7-[4-hydroxy-3-(1-phenylpropan-2-yl)phenoxy]-6-methyl-2,3-dihydro-1H-inden-4-yl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc(C)c(Oc2ccc(O)c(C(C)Cc3ccccc3)c2)c2c1CCC2 |
| InChI | InChI=1S/C30H33NO5/c1-4-35-29(34)18-28(33)31-26-16-20(3)30(24-12-8-11-23(24)26)36-22-13-14-27(32)25(17-22)19(2)15-21-9-6-5-7-10-21/h5-7,9-10,13-14,16-17,19,32H,4,8,11-12,15,18H2,1-3H3,(H,31,33) |
| InChIKey | SXMDWLXSCDUODV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|