About 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid
3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid (PubChem CID 22662666) has the molecular formula C19H18Cl2INO5
and a molecular weight of 538.17 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid |
| PubChem CID | 22662666 |
| Molecular Formula | C19H18Cl2INO5 |
| Molecular Weight | 538.17 g/mol |
| Exact Mass | 536.96 |
| IUPAC Name | 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid |
| SMILES | Cc1c(NC(=O)CC(=O)O)cc(Cl)c(Oc2ccc(O)c(C(C)CI)c2)c1Cl |
| InChI | InChI=1S/C19H18Cl2INO5/c1-9(8-22)12-5-11(3-4-15(12)24)28-19-13(20)6-14(10(2)18(19)21)23-16(25)7-17(26)27/h3-6,9,24H,7-8H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | HROWOJGYIZEOSC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.17 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid?
The IUPAC name of 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid (CID 22662666) is 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid.
What is the SMILES notation for 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid?
The canonical SMILES for 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid is Cc1c(NC(=O)CC(=O)O)cc(Cl)c(Oc2ccc(O)c(C(C)CI)c2)c1Cl.
What is the InChIKey of 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid?
The InChIKey is HROWOJGYIZEOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2INO5/c1-9(8-22)12-5-11(3-4-15(12)24)28-19-13(20)6-14(10(2)18(19)21)23-16(25)7-17(26)27/h3-6,9,24H,7-8H2,1-2H3,(H,23,25)(H,26,27).
What are the key properties of 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid?
3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid has a molecular weight of 538.17 g/mol, XLogP of 5.75, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dichloro-4-[4-hydroxy-3-(1-iodopropan-2-yl)phenoxy]-2-methylanilino]-3-oxopropanoic acid is sourced from PubChem (CID 22662666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).