About 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid
2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid (PubChem CID 87656667) has the molecular formula C20H21Cl2NO5
and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid |
| PubChem CID | 87656667 |
| Molecular Formula | C20H21Cl2NO5 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid |
| SMILES | Cc1cc(Oc2c(Cl)cc(C(=O)NCC(=O)O)c(C)c2Cl)cc(C(C)C)c1O |
| InChI | InChI=1S/C20H21Cl2NO5/c1-9(2)13-6-12(5-10(3)18(13)26)28-19-15(21)7-14(11(4)17(19)22)20(27)23-8-16(24)25/h5-7,9,26H,8H2,1-4H3,(H,23,27)(H,24,25) |
| InChIKey | PSDAKXJTFDIODY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid?
The IUPAC name of 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid (CID 87656667) is 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid.
What is the SMILES notation for 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid?
The canonical SMILES for 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid is Cc1cc(Oc2c(Cl)cc(C(=O)NCC(=O)O)c(C)c2Cl)cc(C(C)C)c1O.
What is the InChIKey of 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid?
The InChIKey is PSDAKXJTFDIODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2NO5/c1-9(2)13-6-12(5-10(3)18(13)26)28-19-15(21)7-14(11(4)17(19)22)20(27)23-8-16(24)25/h5-7,9,26H,8H2,1-4H3,(H,23,27)(H,24,25).
What are the key properties of 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid?
2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid has a molecular weight of 426.30 g/mol, XLogP of 5.05, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dichloro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-methylbenzoyl]amino]acetic acid is sourced from PubChem (CID 87656667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).