C9H7Cl2NO3S — CID 59888525
2-[(2,5-dichloro-4-sulfanylbenzoyl)amino]acetic acid (PubChem CID 59888525) has the molecular formula C9H7Cl2NO3S and a molecular weight of 280.13 g/mol. Its IUPAC name is 2-[(2,5-dichloro-4-sulfanylbenzoyl)amino]acetic acid.
| Compound Name | 2-[(2,5-dichloro-4-sulfanylbenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 59888525 |
| Molecular Formula | C9H7Cl2NO3S |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 2-[(2,5-dichloro-4-sulfanylbenzoyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cc(Cl)c(S)cc1Cl |
| InChI | InChI=1S/C9H7Cl2NO3S/c10-5-2-7(16)6(11)1-4(5)9(15)12-3-8(13)14/h1-2,16H,3H2,(H,12,15)(H,13,14) |
| InChIKey | ZNJFSIWOAZDQBT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|