C18H15Cl2FNO5 — CID 58662834
CID 58662834 (PubChem CID 58662834) has the molecular formula C18H15Cl2FNO5 and a molecular weight of 415.22 g/mol.
| Compound Name | CID 58662834 |
|---|---|
| PubChem CID | 58662834 |
| Molecular Formula | C18H15Cl2FNO5 |
| Molecular Weight | 415.22 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(Oc2c(Cl)cc(C(=O)N[CH]C(=O)O)cc2Cl)cc(F)c1O |
| InChI | InChI=1S/C18H15Cl2FNO5/c1-8(2)11-5-10(6-14(21)16(11)25)27-17-12(19)3-9(4-13(17)20)18(26)22-7-15(23)24/h3-8,25H,1-2H3,(H,22,26)(H,23,24) |
| InChIKey | XYJPWCVAILDPQT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |