C21H24O5 — CID 91355858
[7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate (PubChem CID 91355858) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate.
| Compound Name | [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 91355858 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate |
| SMILES | Cc1cc(OC(=O)CO)c2c(c1Oc1ccc(O)c(C(C)C)c1)CCC2 |
| InChI | InChI=1S/C21H24O5/c1-12(2)17-10-14(7-8-18(17)23)25-21-13(3)9-19(26-20(24)11-22)15-5-4-6-16(15)21/h7-10,12,22-23H,4-6,11H2,1-3H3 |
| InChIKey | XKZAHDSTPRAYKR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|