About [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate
[7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate (PubChem CID 91355858) has the molecular formula C21H24O5
and a molecular weight of 356.42 g/mol. Its IUPAC name is [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate.
Molecular Properties
| Compound Name | [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate |
| PubChem CID | 91355858 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate |
| SMILES | Cc1cc(OC(=O)CO)c2c(c1Oc1ccc(O)c(C(C)C)c1)CCC2 |
| InChI | InChI=1S/C21H24O5/c1-12(2)17-10-14(7-8-18(17)23)25-21-13(3)9-19(26-20(24)11-22)15-5-4-6-16(15)21/h7-10,12,22-23H,4-6,11H2,1-3H3 |
| InChIKey | XKZAHDSTPRAYKR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate?
The IUPAC name of [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate (CID 91355858) is [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate.
What is the SMILES notation for [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate?
The canonical SMILES for [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate is Cc1cc(OC(=O)CO)c2c(c1Oc1ccc(O)c(C(C)C)c1)CCC2.
What is the InChIKey of [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate?
The InChIKey is XKZAHDSTPRAYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O5/c1-12(2)17-10-14(7-8-18(17)23)25-21-13(3)9-19(26-20(24)11-22)15-5-4-6-16(15)21/h7-10,12,22-23H,4-6,11H2,1-3H3.
What are the key properties of [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate?
[7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate has a molecular weight of 356.42 g/mol, XLogP of 4.00, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(4-hydroxy-3-propan-2-ylphenoxy)-6-methyl-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate is sourced from PubChem (CID 91355858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).