C26H27ClF2N4O2S — CID 21111316
[5-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]thiophen-2-yl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 21111316) has the molecular formula C26H27ClF2N4O2S and a molecular weight of 533.04 g/mol. Its IUPAC name is [5-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]thiophen-2-yl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [5-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]thiophen-2-yl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 21111316 |
| Molecular Formula | C26H27ClF2N4O2S |
| Molecular Weight | 533.04 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | [5-[6-amino-5-[(2-chloro-3,6-difluorophenyl)methoxy]-3-pyridinyl]thiophen-2-yl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCCC3CN3CCCC3)s2)cc1OCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C26H27ClF2N4O2S/c27-24-18(19(28)5-6-20(24)29)15-35-21-12-16(13-31-25(21)30)22-7-8-23(36-22)26(34)33-11-3-4-17(33)14-32-9-1-2-10-32/h5-8,12-13,17H,1-4,9-11,14-15H2,(H2,30,31) |
| InChIKey | XWFZAKAZXRHRMQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.04 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|