C23H30N4O7 — CID 21111621
2-ethyl-6-methoxy-5-[[4-(3,4,5-trimethoxyphenyl)piperazine-1-carbonyl]amino]pyridine-3-carboxylic acid (PubChem CID 21111621) has the molecular formula C23H30N4O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-5-[[4-(3,4,5-trimethoxyphenyl)piperazine-1-carbonyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 2-ethyl-6-methoxy-5-[[4-(3,4,5-trimethoxyphenyl)piperazine-1-carbonyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 21111621 |
| Molecular Formula | C23H30N4O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-ethyl-6-methoxy-5-[[4-(3,4,5-trimethoxyphenyl)piperazine-1-carbonyl]amino]pyridine-3-carboxylic acid |
| SMILES | CCc1nc(OC)c(NC(=O)N2CCN(c3cc(OC)c(OC)c(OC)c3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C23H30N4O7/c1-6-16-15(22(28)29)13-17(21(24-16)34-5)25-23(30)27-9-7-26(8-10-27)14-11-18(31-2)20(33-4)19(12-14)32-3/h11-13H,6-10H2,1-5H3,(H,25,30)(H,28,29) |
| InChIKey | FWBVBCCKUURQAZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|