C7H14N2S2 — CID 21115232
(2S,5R)-2,5-dimethylpiperazine-1-carbodithioic acid (PubChem CID 21115232) has the molecular formula C7H14N2S2 and a molecular weight of 190.34 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethylpiperazine-1-carbodithioic acid.
| Compound Name | (2S,5R)-2,5-dimethylpiperazine-1-carbodithioic acid |
|---|---|
| PubChem CID | 21115232 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2S,5R)-2,5-dimethylpiperazine-1-carbodithioic acid |
| SMILES | C[C@@H]1CN(C(=S)S)[C@@H](C)CN1 |
| InChI | InChI=1S/C7H14N2S2/c1-5-4-9(7(10)11)6(2)3-8-5/h5-6,8H,3-4H2,1-2H3,(H,10,11)/t5-,6+/m1/s1 |
| InChIKey | WZGAXFZTASRQJD-RITPCOANSA-N |
| XLogP | 0.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|